Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Ammonium oxalate monohydrate, ACS, 99.0-101.0%
CAS: 6009-70-7 Molecular Formula: C2H10N2O5 Molecular Weight (g/mol): 142.111 MDL Number: MFCD00149694 InChI Key: MSMNVXKYCPHLLN-UHFFFAOYSA-N Synonym: ammonium oxalate monohydrate,ammonium oxalate monohydrate, acs,ethanedioic acid, diammonium salt, monohydrate,diazanium oxalate hydrate,acmc-1aw90,ksc493e5j,diammonium hydrate oxalate,oxalic acid ammonium salt monohydrate PubChem CID: 516808 IUPAC Name: diazanium;oxalate;hydrate SMILES: C(=O)(C(=O)[O-])[O-].[NH4+].[NH4+].O
| PubChem CID | 516808 |
|---|---|
| CAS | 6009-70-7 |
| Molecular Weight (g/mol) | 142.111 |
| MDL Number | MFCD00149694 |
| SMILES | C(=O)(C(=O)[O-])[O-].[NH4+].[NH4+].O |
| Synonym | ammonium oxalate monohydrate,ammonium oxalate monohydrate, acs,ethanedioic acid, diammonium salt, monohydrate,diazanium oxalate hydrate,acmc-1aw90,ksc493e5j,diammonium hydrate oxalate,oxalic acid ammonium salt monohydrate |
| IUPAC Name | diazanium;oxalate;hydrate |
| InChI Key | MSMNVXKYCPHLLN-UHFFFAOYSA-N |
| Molecular Formula | C2H10N2O5 |
Silicon(IV) oxide, powder, 1.5 micron, 99.9%
CAS: 7631-86-9 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: dioxosilane SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 7631-86-9 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | dioxosilane |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Silicon(IV) oxide, 99% (metals basis)
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 14808-60-7 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Potassium perchlorate, 99%
CAS: 7778-74-7 Molecular Formula: ClKO4 Molecular Weight (g/mol): 138.54 MDL Number: MFCD00011362 InChI Key: YLMGFJXSLBMXHK-UHFFFAOYSA-M Synonym: potassium perchlorate,perchloracap,astrumal,peroidin,perchloric acid, potassium salt,irenat,potassium hyperchloride,perchloric acid, potassium salt 1:1,potassium perchlorate kclo4,potassium perchlorate usp PubChem CID: 516900 SMILES: [K+].[O-][Cl](=O)(=O)=O
| PubChem CID | 516900 |
|---|---|
| CAS | 7778-74-7 |
| Molecular Weight (g/mol) | 138.54 |
| MDL Number | MFCD00011362 |
| SMILES | [K+].[O-][Cl](=O)(=O)=O |
| Synonym | potassium perchlorate,perchloracap,astrumal,peroidin,perchloric acid, potassium salt,irenat,potassium hyperchloride,perchloric acid, potassium salt 1:1,potassium perchlorate kclo4,potassium perchlorate usp |
| InChI Key | YLMGFJXSLBMXHK-UHFFFAOYSA-M |
| Molecular Formula | ClKO4 |
Lithium perchlorate, anhydrous, ACS, 95.0% min
CAS: 3-9-7791 Molecular Formula: ClH6LiO7 Molecular Weight (g/mol): 160.43 MDL Number: MFCD00011079 InChI Key: JAWYRNYHJJDXHX-UHFFFAOYSA-M Synonym: lithium perchlorate,perchloric acid, lithium salt,lithiumperchlorate,unii-q86se98c9c,lithium 1+ ion perchlorate,lithium perchlorate, anhydrous,lithium cloricum,lithium per chlorate,liclo4,perchloric acid, lithium salt 1:1 PubChem CID: 23665649 IUPAC Name: lithium;perchlorate SMILES: [Li+].[O-]Cl(=O)(=O)=O
| PubChem CID | 23665649 |
|---|---|
| CAS | 3-9-7791 |
| Molecular Weight (g/mol) | 160.43 |
| MDL Number | MFCD00011079 |
| SMILES | [Li+].[O-]Cl(=O)(=O)=O |
| Synonym | lithium perchlorate,perchloric acid, lithium salt,lithiumperchlorate,unii-q86se98c9c,lithium 1+ ion perchlorate,lithium perchlorate, anhydrous,lithium cloricum,lithium per chlorate,liclo4,perchloric acid, lithium salt 1:1 |
| IUPAC Name | lithium;perchlorate |
| InChI Key | JAWYRNYHJJDXHX-UHFFFAOYSA-M |
| Molecular Formula | ClH6LiO7 |
Vanadium wire, 1.0mm (0.04in) dia, 99.5% (metals basis)
CAS: 7440-62-2 Molecular Formula: V Molecular Weight (g/mol): 50.94 MDL Number: MFCD00011453 InChI Key: LEONUFNNVUYDNQ-UHFFFAOYSA-N Synonym: dust,vanadium, elemental,ion,iii,1+ , ion,vanadium, ion 3+,fume or dust,vanadium, ion v5+,unii-00j9j9xkde,00j9j9xkde PubChem CID: 23990 ChEBI: CHEBI:35170 IUPAC Name: vanadium SMILES: [V]
| PubChem CID | 23990 |
|---|---|
| CAS | 7440-62-2 |
| Molecular Weight (g/mol) | 50.94 |
| ChEBI | CHEBI:35170 |
| MDL Number | MFCD00011453 |
| SMILES | [V] |
| Synonym | dust,vanadium, elemental,ion,iii,1+ , ion,vanadium, ion 3+,fume or dust,vanadium, ion v5+,unii-00j9j9xkde,00j9j9xkde |
| IUPAC Name | vanadium |
| InChI Key | LEONUFNNVUYDNQ-UHFFFAOYSA-N |
| Molecular Formula | V |
Silver(I) oxide, 99.99% (metals basis)
CAS: 20667-12-3 Molecular Formula: Ag2O Molecular Weight (g/mol): 231.74 MDL Number: MFCD00003404 InChI Key: KHJDQHIZCZTCAE-UHFFFAOYSA-N IUPAC Name: (argentiooxy)silver SMILES: [Ag]O[Ag]
| CAS | 20667-12-3 |
|---|---|
| Molecular Weight (g/mol) | 231.74 |
| MDL Number | MFCD00003404 |
| SMILES | [Ag]O[Ag] |
| IUPAC Name | (argentiooxy)silver |
| InChI Key | KHJDQHIZCZTCAE-UHFFFAOYSA-N |
| Molecular Formula | Ag2O |
Tin(II) chloride dihydrate, 97%
CAS: 10025-69-1 Molecular Formula: Cl2Sn·2H2O Molecular Weight (g/mol): 225.63 MDL Number: MFCD00149863 Synonym: Stannous chloride dihydrate
| CAS | 10025-69-1 |
|---|---|
| Molecular Weight (g/mol) | 225.63 |
| MDL Number | MFCD00149863 |
| Synonym | Stannous chloride dihydrate |
| Molecular Formula | Cl2Sn·2H2O |
Aluminum chloride hexahydrate, Puratronic™, 99.9995% (metals basis)
CAS: 7784-13-6 Molecular Formula: AlCl3H12O6 Molecular Weight (g/mol): 241.42 MDL Number: MFCD00149134 InChI Key: JGDITNMASUZKPW-UHFFFAOYSA-K IUPAC Name: aluminium(3+) hexahydrate trichloride SMILES: O.O.O.O.O.O.[Al+3].[Cl-].[Cl-].[Cl-]
| CAS | 7784-13-6 |
|---|---|
| Molecular Weight (g/mol) | 241.42 |
| MDL Number | MFCD00149134 |
| SMILES | O.O.O.O.O.O.[Al+3].[Cl-].[Cl-].[Cl-] |
| IUPAC Name | aluminium(3+) hexahydrate trichloride |
| InChI Key | JGDITNMASUZKPW-UHFFFAOYSA-K |
| Molecular Formula | AlCl3H12O6 |
Manganese(II) sulfate monohydrate, 99+%, extra pure
CAS: 10034-96-5 Molecular Formula: H2MnO5S Molecular Weight (g/mol): 169.01 MDL Number: MFCD00149159 InChI Key: ISPYRSDWRDQNSW-UHFFFAOYSA-L Synonym: manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate PubChem CID: 177577 ChEBI: CHEBI:86364 IUPAC Name: manganese(2+);sulfate;hydrate SMILES: O.[Mn++].[O-]S([O-])(=O)=O
| PubChem CID | 177577 |
|---|---|
| CAS | 10034-96-5 |
| Molecular Weight (g/mol) | 169.01 |
| ChEBI | CHEBI:86364 |
| MDL Number | MFCD00149159 |
| SMILES | O.[Mn++].[O-]S([O-])(=O)=O |
| Synonym | manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate |
| IUPAC Name | manganese(2+);sulfate;hydrate |
| InChI Key | ISPYRSDWRDQNSW-UHFFFAOYSA-L |
| Molecular Formula | H2MnO5S |
Palladium(II) nitrate hydrate, 99.8% (metals basis), Pd 39% min
CAS: 207596-32-5 Molecular Formula: N2O6Pd Molecular Weight (g/mol): 230.43 MDL Number: MFCD00011169 InChI Key: GPNDARIEYHPYAY-UHFFFAOYSA-N Synonym: palladium nitrate,palladium ii nitrate,palladous nitrate,palladium dinitrate,unii-5g27lbz05u,nitric acid, palladium 2+ salt,hydrogen tetranitropalladate ii,palladium 2+ dinitrate,palladiumdinitrate PubChem CID: 24932 IUPAC Name: palladium(2+);dinitrate SMILES: [Pd++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24932 |
|---|---|
| CAS | 207596-32-5 |
| Molecular Weight (g/mol) | 230.43 |
| MDL Number | MFCD00011169 |
| SMILES | [Pd++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | palladium nitrate,palladium ii nitrate,palladous nitrate,palladium dinitrate,unii-5g27lbz05u,nitric acid, palladium 2+ salt,hydrogen tetranitropalladate ii,palladium 2+ dinitrate,palladiumdinitrate |
| IUPAC Name | palladium(2+);dinitrate |
| InChI Key | GPNDARIEYHPYAY-UHFFFAOYSA-N |
| Molecular Formula | N2O6Pd |
Ammonium Sulfate, MP Biomedicals™
CAS: 7783-20-2 Molecular Formula: H8N2O4S Molecular Weight (g/mol): 132.13 MDL Number: MFCD00003391 InChI Key: BFNBIHQBYMNNAN-UHFFFAOYSA-N Synonym: ammonium sulfate,diammonium sulfate,ammonium sulphate,mascagnite,sulfuric acid diammonium salt,ammonium sulfate 2:1,ammoniumsulfate,actamaster,sulfuric acid, diammonium salt,diammonium sulphate PubChem CID: 6097028 ChEBI: CHEBI:62946 IUPAC Name: sulfuric acid diamine SMILES: N.N.OS(O)(=O)=O
| PubChem CID | 6097028 |
|---|---|
| CAS | 7783-20-2 |
| Molecular Weight (g/mol) | 132.13 |
| ChEBI | CHEBI:62946 |
| MDL Number | MFCD00003391 |
| SMILES | N.N.OS(O)(=O)=O |
| Synonym | ammonium sulfate,diammonium sulfate,ammonium sulphate,mascagnite,sulfuric acid diammonium salt,ammonium sulfate 2:1,ammoniumsulfate,actamaster,sulfuric acid, diammonium salt,diammonium sulphate |
| IUPAC Name | sulfuric acid diamine |
| InChI Key | BFNBIHQBYMNNAN-UHFFFAOYSA-N |
| Molecular Formula | H8N2O4S |
Antimony(V) oxide, Puratronic™, 99.998% (metals basis)
CAS: 1314-60-9 Molecular Formula: O5Sb2 Molecular Weight (g/mol): 323.515 MDL Number: MFCD00011216 InChI Key: LJCFOYOSGPHIOO-UHFFFAOYSA-N Synonym: antimony pentoxide,diantimony pentoxide,antimonic oxide,antimony v oxide,diantimony pentaoxide,stibic anhydride,antimony pentaoxide,apox s,antimony oxide sb2o5,nyacol ago 40 PubChem CID: 14813 IUPAC Name: (dioxo-$l^{5}-stibanyl)oxy-dioxo-$l^{5}-stibane SMILES: O=[Sb](=O)O[Sb](=O)=O
| PubChem CID | 14813 |
|---|---|
| CAS | 1314-60-9 |
| Molecular Weight (g/mol) | 323.515 |
| MDL Number | MFCD00011216 |
| SMILES | O=[Sb](=O)O[Sb](=O)=O |
| Synonym | antimony pentoxide,diantimony pentoxide,antimonic oxide,antimony v oxide,diantimony pentaoxide,stibic anhydride,antimony pentaoxide,apox s,antimony oxide sb2o5,nyacol ago 40 |
| IUPAC Name | (dioxo-$l^{5}-stibanyl)oxy-dioxo-$l^{5}-stibane |
| InChI Key | LJCFOYOSGPHIOO-UHFFFAOYSA-N |
| Molecular Formula | O5Sb2 |
Cupric Nitrate Hydrate, MP Biomedicals
CAS: 10031-43-3 Molecular Formula: CuH6N2O9 Molecular Weight (g/mol): 241.599 InChI Key: SXTLQDJHRPXDSB-UHFFFAOYSA-N Synonym: copper ii nitrate trihydrate,copper nitrate trihydrate,cupric nitrate trihydrate,copper ii nitrate hydrate,copper ii nitrate 3-hydrate,copper 2+ trihydrate dinitronate,copper 2+ trihydrate dinitrate,copper ii nitrate trihydrate-cu puratrem PubChem CID: 9837674 IUPAC Name: copper;dinitrate;trihydrate SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.[Cu+2]
| PubChem CID | 9837674 |
|---|---|
| CAS | 10031-43-3 |
| Molecular Weight (g/mol) | 241.599 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.[Cu+2] |
| Synonym | copper ii nitrate trihydrate,copper nitrate trihydrate,cupric nitrate trihydrate,copper ii nitrate hydrate,copper ii nitrate 3-hydrate,copper 2+ trihydrate dinitronate,copper 2+ trihydrate dinitrate,copper ii nitrate trihydrate-cu puratrem |
| IUPAC Name | copper;dinitrate;trihydrate |
| InChI Key | SXTLQDJHRPXDSB-UHFFFAOYSA-N |
| Molecular Formula | CuH6N2O9 |
Sodium tin(IV) oxide trihydrate, 96%
CAS: 12209-98-2 Molecular Formula: H6Na2O6Sn Molecular Weight (g/mol): 266.732 MDL Number: MFCD00150189 InChI Key: SFXJSNATBHJIDS-UHFFFAOYSA-N Synonym: sodium stannate trihydrate,unii-nj7c1v83kg,nj7c1v83kg,sodium stannate inci,sodium stannate vandf,disodium stannate, trihydrate,sodium stannate iv trihydrate mi,2na.so3n.3h2o,sodiumstannatetrihydrate,sodium tin iv oxide trihydrate PubChem CID: 21977542 IUPAC Name: disodium;dioxido(oxo)tin;trihydrate SMILES: O.O.O.[O-][Sn](=O)[O-].[Na+].[Na+]
| PubChem CID | 21977542 |
|---|---|
| CAS | 12209-98-2 |
| Molecular Weight (g/mol) | 266.732 |
| MDL Number | MFCD00150189 |
| SMILES | O.O.O.[O-][Sn](=O)[O-].[Na+].[Na+] |
| Synonym | sodium stannate trihydrate,unii-nj7c1v83kg,nj7c1v83kg,sodium stannate inci,sodium stannate vandf,disodium stannate, trihydrate,sodium stannate iv trihydrate mi,2na.so3n.3h2o,sodiumstannatetrihydrate,sodium tin iv oxide trihydrate |
| IUPAC Name | disodium;dioxido(oxo)tin;trihydrate |
| InChI Key | SFXJSNATBHJIDS-UHFFFAOYSA-N |
| Molecular Formula | H6Na2O6Sn |