Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Silicon carbide, beta-phase, nanopowder
CAS: 409-21-2 Molecular Formula: CSi Molecular Weight (g/mol): 40.10 MDL Number: MFCD00049531 InChI Key: HBMJWWWQQXIZIP-UHFFFAOYSA-N Synonym: silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide PubChem CID: 9863 ChEBI: CHEBI:29390 SMILES: [C-]#[Si+]
| PubChem CID | 9863 |
|---|---|
| CAS | 409-21-2 |
| Molecular Weight (g/mol) | 40.10 |
| ChEBI | CHEBI:29390 |
| MDL Number | MFCD00049531 |
| SMILES | [C-]#[Si+] |
| Synonym | silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide |
| InChI Key | HBMJWWWQQXIZIP-UHFFFAOYSA-N |
| Molecular Formula | CSi |
Sodium Nitrite, (USP/FCC), MP Biomedicals
CAS: 7632-00-0 Molecular Formula: NNaO2 Molecular Weight (g/mol): 69.00 MDL Number: MFCD00011118 InChI Key: LPXPTNMVRIOKMN-UHFFFAOYSA-M Synonym: sodium nitrite,nitrous acid, sodium salt,sodiumnitrite,erinitrit,filmerine,natrium nitrit,nitrito sodico,anti-rust,nitrite, sodium,diazotizing salts PubChem CID: 23668193 ChEBI: CHEBI:78870 IUPAC Name: sodium nitrite SMILES: [Na+].[O-]N=O
| PubChem CID | 23668193 |
|---|---|
| CAS | 7632-00-0 |
| Molecular Weight (g/mol) | 69.00 |
| ChEBI | CHEBI:78870 |
| MDL Number | MFCD00011118 |
| SMILES | [Na+].[O-]N=O |
| Synonym | sodium nitrite,nitrous acid, sodium salt,sodiumnitrite,erinitrit,filmerine,natrium nitrit,nitrito sodico,anti-rust,nitrite, sodium,diazotizing salts |
| IUPAC Name | sodium nitrite |
| InChI Key | LPXPTNMVRIOKMN-UHFFFAOYSA-M |
| Molecular Formula | NNaO2 |
Nickel nitrate, Matrix Modifier Solution, Specpure™
CAS: 7697-37-2 Molecular Formula: HNO3 Molecular Weight (g/mol): 63.01 MDL Number: MFCD00011349 InChI Key: GRYLNZFGIOXLOG-UHFFFAOYSA-N Synonym: hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide PubChem CID: 944 ChEBI: CHEBI:48107 IUPAC Name: nitric acid SMILES: O[N+]([O-])=O
| PubChem CID | 944 |
|---|---|
| CAS | 7697-37-2 |
| Molecular Weight (g/mol) | 63.01 |
| ChEBI | CHEBI:48107 |
| MDL Number | MFCD00011349 |
| SMILES | O[N+]([O-])=O |
| Synonym | hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide |
| IUPAC Name | nitric acid |
| InChI Key | GRYLNZFGIOXLOG-UHFFFAOYSA-N |
| Molecular Formula | HNO3 |
| CAS | 10486-00-7 |
|---|---|
| MDL Number | MFCD00149231 |
Cerium(IV) sulfate, anhydrous, 97%
CAS: 13590-82-4 Molecular Formula: CeO8S2 Molecular Weight (g/mol): 332.23 MDL Number: MFCD00148852 InChI Key: VZDYWEUILIUIDF-UHFFFAOYSA-J Synonym: ceric sulfate,cerium iv sulfate,ceric disulfate,ceric sulphate,cerium disulfate,cerium 4+ sulfate,cerium 4+ disulphate,unii-4f66fi5t7x,sulfuric acid, cerium 4+ salt 2:1,cerium 4+ disulfate PubChem CID: 159684 IUPAC Name: cerium(4+);disulfate SMILES: [Ce+4].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O
| PubChem CID | 159684 |
|---|---|
| CAS | 13590-82-4 |
| Molecular Weight (g/mol) | 332.23 |
| MDL Number | MFCD00148852 |
| SMILES | [Ce+4].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O |
| Synonym | ceric sulfate,cerium iv sulfate,ceric disulfate,ceric sulphate,cerium disulfate,cerium 4+ sulfate,cerium 4+ disulphate,unii-4f66fi5t7x,sulfuric acid, cerium 4+ salt 2:1,cerium 4+ disulfate |
| IUPAC Name | cerium(4+);disulfate |
| InChI Key | VZDYWEUILIUIDF-UHFFFAOYSA-J |
| Molecular Formula | CeO8S2 |
Sodium chloride, crystalline powder PDV, 99+%
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 IUPAC Name: sodium chloride SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| IUPAC Name | sodium chloride |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Sodium chromate tetrahydrate, 99+%
CAS: 10034-82-9 Molecular Formula: CrH8Na2O8 Molecular Weight (g/mol): 234.032 MDL Number: MFCD00149167 InChI Key: AVHUVTPOXZEIRG-UHFFFAOYSA-N Synonym: sodium chromate tetrahydrate,cro4.2na.4h2o,acmc-20ajol,disodium chromate tetrahydrate,ksc492q3d,disodium chromate 2-tetrahydrate,sodium chromate tetrahydrate, reagent grade,sodium chromate tetrahydrate, p.a PubChem CID: 22146515 IUPAC Name: disodium;dioxido(dioxo)chromium;tetrahydrate SMILES: O.O.O.O.[O-][Cr](=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 22146515 |
|---|---|
| CAS | 10034-82-9 |
| Molecular Weight (g/mol) | 234.032 |
| MDL Number | MFCD00149167 |
| SMILES | O.O.O.O.[O-][Cr](=O)(=O)[O-].[Na+].[Na+] |
| Synonym | sodium chromate tetrahydrate,cro4.2na.4h2o,acmc-20ajol,disodium chromate tetrahydrate,ksc492q3d,disodium chromate 2-tetrahydrate,sodium chromate tetrahydrate, reagent grade,sodium chromate tetrahydrate, p.a |
| IUPAC Name | disodium;dioxido(dioxo)chromium;tetrahydrate |
| InChI Key | AVHUVTPOXZEIRG-UHFFFAOYSA-N |
| Molecular Formula | CrH8Na2O8 |
Sodium sulfite, 98.5%, for analysis, anhydrous
CAS: 7757-83-7 Molecular Formula: Na2O3S Molecular Weight (g/mol): 126.04 MDL Number: MFCD00003503 InChI Key: GEHJYWRUCIMESM-UHFFFAOYSA-L Synonym: sodium sulfite,disodium sulfite,sodium sulphite,sodium sulfite anhydrous,sulfurous acid, disodium salt,sulftech,natrium sulfurosum,sodiumsulfite,natriumsulfid,natriumsulfit PubChem CID: 24437 ChEBI: CHEBI:86477 IUPAC Name: disodium;sulfite SMILES: [O-]S(=O)[O-].[Na+].[Na+]
| PubChem CID | 24437 |
|---|---|
| CAS | 7757-83-7 |
| Molecular Weight (g/mol) | 126.04 |
| ChEBI | CHEBI:86477 |
| MDL Number | MFCD00003503 |
| SMILES | [O-]S(=O)[O-].[Na+].[Na+] |
| Synonym | sodium sulfite,disodium sulfite,sodium sulphite,sodium sulfite anhydrous,sulfurous acid, disodium salt,sulftech,natrium sulfurosum,sodiumsulfite,natriumsulfid,natriumsulfit |
| IUPAC Name | disodium;sulfite |
| InChI Key | GEHJYWRUCIMESM-UHFFFAOYSA-L |
| Molecular Formula | Na2O3S |
tert-Butyldiphenylchlorosilane, 97%
CAS: 58479-61-1 Molecular Formula: C16H19ClSi Molecular Weight (g/mol): 274.863 MDL Number: MFCD00000497 InChI Key: MHYGQXWCZAYSLJ-UHFFFAOYSA-N Synonym: tert-butylchlorodiphenylsilane,tert-butyldiphenylchlorosilane,t-butyldiphenylchlorosilane,silane, chloro 1,1-dimethylethyl diphenyl,tert-butyl chloro diphenylsilane,t-butylchlorodiphenylsilane,tbdpscl,t-butyldiphenylsilyl chloride,tert-butyldiphenyl chlorosilane,unii-3beu48ui4e PubChem CID: 94078 IUPAC Name: tert-butyl-chloro-diphenylsilane SMILES: CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)Cl
| PubChem CID | 94078 |
|---|---|
| CAS | 58479-61-1 |
| Molecular Weight (g/mol) | 274.863 |
| MDL Number | MFCD00000497 |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)Cl |
| Synonym | tert-butylchlorodiphenylsilane,tert-butyldiphenylchlorosilane,t-butyldiphenylchlorosilane,silane, chloro 1,1-dimethylethyl diphenyl,tert-butyl chloro diphenylsilane,t-butylchlorodiphenylsilane,tbdpscl,t-butyldiphenylsilyl chloride,tert-butyldiphenyl chlorosilane,unii-3beu48ui4e |
| IUPAC Name | tert-butyl-chloro-diphenylsilane |
| InChI Key | MHYGQXWCZAYSLJ-UHFFFAOYSA-N |
| Molecular Formula | C16H19ClSi |
Strontium fluoride, Puratronic™, 99.99% (metals basis)
CAS: 7783-48-4 Molecular Formula: F2Sr Molecular Weight (g/mol): 125.62 MDL Number: MFCD00011251 InChI Key: FVRNDBHWWSPNOM-UHFFFAOYSA-L Synonym: strontium difluoride,unii-efy8gjs81z,strontium fluoride srf2,efy8gjs81z,strontium 2+ ion difluoride,fluoride, sr, fluoride,strontium 2+ difluoride,beta-bromo isovaleric acid,ksc379a4r,strontium fluoride 250g PubChem CID: 82210 SMILES: [F-].[F-].[Sr++]
| PubChem CID | 82210 |
|---|---|
| CAS | 7783-48-4 |
| Molecular Weight (g/mol) | 125.62 |
| MDL Number | MFCD00011251 |
| SMILES | [F-].[F-].[Sr++] |
| Synonym | strontium difluoride,unii-efy8gjs81z,strontium fluoride srf2,efy8gjs81z,strontium 2+ ion difluoride,fluoride, sr, fluoride,strontium 2+ difluoride,beta-bromo isovaleric acid,ksc379a4r,strontium fluoride 250g |
| InChI Key | FVRNDBHWWSPNOM-UHFFFAOYSA-L |
| Molecular Formula | F2Sr |
Sodium metaborate tetrahydrate, 98.5%, extra pure
CAS: 10555-76-7 Molecular Formula: BH8NaO6 Molecular Weight (g/mol): 137.86 MDL Number: MFCD00149205 InChI Key: JAKYJVJWXKRTSJ-UHFFFAOYSA-N Synonym: sodium metaborate tetrahydrate,sodium tetrahydrate oxoborinate,na.bo2.4h2o,boric acid, sodium salt, tetrahydrate PubChem CID: 23694267 SMILES: O.O.O.O.[Na+].[O-]B=O
| PubChem CID | 23694267 |
|---|---|
| CAS | 10555-76-7 |
| Molecular Weight (g/mol) | 137.86 |
| MDL Number | MFCD00149205 |
| SMILES | O.O.O.O.[Na+].[O-]B=O |
| Synonym | sodium metaborate tetrahydrate,sodium tetrahydrate oxoborinate,na.bo2.4h2o,boric acid, sodium salt, tetrahydrate |
| InChI Key | JAKYJVJWXKRTSJ-UHFFFAOYSA-N |
| Molecular Formula | BH8NaO6 |
Iron(III) sulfate pentahydrate, 97%
CAS: 142906-29-4 Molecular Formula: Fe2O12S3·5H2O Molecular Weight (g/mol): 489.96 MDL Number: MFCD00149714 InChI Key: YHGPYBQVSJBGHH-UHFFFAOYSA-H Synonym: unii-3hws7hf5xd,3hws7hf5xd,iron iii sulfate pentahydrate,sulfuric acid, iron 3+ salt 3:2 , pentahydrate 9ci,acmc-20n1we,ferric sulfate pentahydrate,iron iii sulphate pentahydrate,2fe.3so4.5h2o,sulfuric acid, iron 3+ salt 3:2 , pentahydrate PubChem CID: 23443659 IUPAC Name: iron(3+);trisulfate;pentahydrate SMILES: O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Fe+3].[Fe+3]
| PubChem CID | 23443659 |
|---|---|
| CAS | 142906-29-4 |
| Molecular Weight (g/mol) | 489.96 |
| MDL Number | MFCD00149714 |
| SMILES | O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Fe+3].[Fe+3] |
| Synonym | unii-3hws7hf5xd,3hws7hf5xd,iron iii sulfate pentahydrate,sulfuric acid, iron 3+ salt 3:2 , pentahydrate 9ci,acmc-20n1we,ferric sulfate pentahydrate,iron iii sulphate pentahydrate,2fe.3so4.5h2o,sulfuric acid, iron 3+ salt 3:2 , pentahydrate |
| IUPAC Name | iron(3+);trisulfate;pentahydrate |
| InChI Key | YHGPYBQVSJBGHH-UHFFFAOYSA-H |
| Molecular Formula | Fe2O12S3·5H2O |
Cerium(IV) oxide, REacton™, 99.9% (REO)
CAS: 1306-38-3 Molecular Formula: CeO2 Molecular Weight (g/mol): 172.114 MDL Number: MFCD00010933 InChI Key: CETPSERCERDGAM-UHFFFAOYSA-N Synonym: ceric oxide,cerium dioxide,cerium iv oxide,ceria,cerium oxide,ceric dioxide,cerium 4+ oxide,needlal,nidoral,opaline PubChem CID: 73963 ChEBI: CHEBI:79089 IUPAC Name: dioxocerium SMILES: O=[Ce]=O
| PubChem CID | 73963 |
|---|---|
| CAS | 1306-38-3 |
| Molecular Weight (g/mol) | 172.114 |
| ChEBI | CHEBI:79089 |
| MDL Number | MFCD00010933 |
| SMILES | O=[Ce]=O |
| Synonym | ceric oxide,cerium dioxide,cerium iv oxide,ceria,cerium oxide,ceric dioxide,cerium 4+ oxide,needlal,nidoral,opaline |
| IUPAC Name | dioxocerium |
| InChI Key | CETPSERCERDGAM-UHFFFAOYSA-N |
| Molecular Formula | CeO2 |
Lanthanum(III) oxide, REacton™, 99.999% (REO)
CAS: 1312-81-8 Molecular Formula: La2O3 MDL Number: MFCD00011071
| CAS | 1312-81-8 |
|---|---|
| MDL Number | MFCD00011071 |
| Molecular Formula | La2O3 |